Difference between revisions of "CPD-206"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7253 RXN-7253] == * direction: ** LEFT-TO-RIGHT * common name: ** myo-inositol-1(or_4)-monophos...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* common name: | * common name: | ||
− | ** | + | ** phytanoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J |
+ | * molecular weight: | ||
+ | ** 1058.022 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[1.14.11.18-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-482]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658363 90658363] |
− | {{#set: | + | * HMDB : HMDB01359 |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15538 15538] | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02060 C02060] |
− | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
+ | {{#set: common name=phytanoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J}} | ||
+ | {{#set: molecular weight=1058.022 }} | ||
+ | {{#set: consumed by=1.14.11.18-RXN}} | ||
+ | {{#set: produced by=RXN66-482}} |
Latest revision as of 21:11, 21 March 2018
Contents
Metabolite CPD-206
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- phytanoyl-CoA
- inchi key:
- InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J
- molecular weight:
- 1058.022
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.