Difference between revisions of "CPD-7025"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1586 == * right end position: ** 8637 * transcription direction: ** POSITIVE * left end position: ** 7270 * centisome position: ** 31.55108...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C |
| − | * | + | * common name: |
| − | ** | + | ** phytyl monophosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 374.499 |
* Synonym(s): | * Synonym(s): | ||
| + | ** phytolmonophosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-7683]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483] |
| − | {{#set: | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}} |
| − | {{#set: | + | {{#set: common name=phytyl monophosphate}} |
| + | {{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}} | ||
| + | {{#set: molecular weight=374.499 }} | ||
| + | {{#set: common name=phytolmonophosphate}} | ||
| + | {{#set: produced by=RXN-7683}} | ||
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-7025
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
- common name:
- phytyl monophosphate
- inchi key:
- InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
- molecular weight:
- 374.499
- Synonym(s):
- phytolmonophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C" cannot be used as a page name in this wiki.
