Difference between revisions of "BIO-5-AMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5527 == * right end position: ** 11299 * transcription direction: ** POSITIVE * left end position: ** 10533 * centisome position: ** 79.141...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5527 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
−
* right end position:
+
* smiles:
−
** 11299
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** biotinyl-5'-adenylate
−
* left end position:
+
* inchi key:
−
** 10533
+
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
−
* centisome position:
+
* molecular weight:
−
** 79.14193    
+
** 572.509    
 
* Synonym(s):
 
* Synonym(s):
 +
** biotinyl-5'-AMP
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Source: [[annotation-in-silico_annotation]]
+
* [[RXN0-7192]]
−
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: right end position=11299}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
−
{{#set: left end position=10533}}
+
* HMDB : HMDB04220
−
{{#set: centisome position=79.14193   }}
+
* CHEBI:
−
{{#set: reaction associated=ATPASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
 +
{{#set: common name=biotinyl-5'-adenylate}}
 +
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
 +
{{#set: molecular weight=572.509   }}
 +
{{#set: common name=biotinyl-5'-AMP}}
 +
{{#set: produced by=RXN0-7192}}

Latest revision as of 20:11, 21 March 2018

Metabolite BIO-5-AMP

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
  • common name:
    • biotinyl-5'-adenylate
  • inchi key:
    • InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
  • molecular weight:
    • 572.509
  • Synonym(s):
    • biotinyl-5'-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BIO-5-AMP&oldid=46725"