Difference between revisions of "Tiso gene 17704"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-881 CPD-881] == * smiles: ** CC(C=CC1(=C(CCCC1(C)C)C))=CC=CC(=CC=O)C * common name: ** 11-c...") |
(Created page with "Category:Gene == Gene Tiso_gene_17704 == * right end position: ** 3028 * transcription direction: ** POSITIVE * left end position: ** 149 * centisome position: ** 4.241389...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17704 == |
− | * | + | * right end position: |
− | ** | + | ** 3028 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 149 |
− | * | + | * centisome position: |
− | ** | + | ** 4.2413893 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[HOMOSERKIN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-702]] | ||
+ | * [[HOMOSER-THRESYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3028}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=149}} | |
− | + | {{#set: centisome position=4.2413893 }} | |
− | + | {{#set: reaction associated=HOMOSERKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-702|HOMOSER-THRESYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_17704
- right end position:
- 3028
- transcription direction:
- POSITIVE
- left end position:
- 149
- centisome position:
- 4.2413893
- Synonym(s):
Reactions associated
- Reaction: HOMOSERKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation