Difference between revisions of "CPD-731"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3113 == * Synonym(s): == Reactions associated == * Reaction: NADH-DEHYDROG-A-RXN ** Source: orthology-esiliculosus * Reaction: N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * common name: ** (+)-7-iso-jasm...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_3113 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] ==
 +
* smiles:
 +
** CCC=CCC1(C(=O)CCC1CC([O-])=O)
 +
* common name:
 +
** (+)-7-iso-jasmonate
 +
* inchi key:
 +
** InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M
 +
* molecular weight:
 +
** 209.264   
 
* Synonym(s):
 
* Synonym(s):
 +
** (+)-7-iso-jasmonic acid
 +
** iso-jasmonic acid
 +
** (3R,7S)-(+)-7-iso-jasmonate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[NADH-DEHYDROG-A-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[orthology-esiliculosus]]
+
* [[RXN-10708]]
* Reaction: [[NADHor_2m]]
+
== Reaction(s) of unknown directionality ==
** Source: [[orthology-creinhardtii]]
+
== Pathways associated ==
+
* [[PWY-6692]]
+
* [[PWY-3781]]
+
* [[PWY-5083]]
+
* [[PWY0-1334]]
+
* [[PWY0-1335]]
+
* [[PWY-4302]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|NADHor_2m}}
+
* LIPID_MAPS : LMFA02020003
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7251182 7251182]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5584838.html 5584838]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18435 18435]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16317 C16317]
 +
{{#set: smiles=CCC=CCC1(C(=O)CCC1CC([O-])=O)}}
 +
{{#set: common name=(+)-7-iso-jasmonate}}
 +
{{#set: inchi key=InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M}}
 +
{{#set: molecular weight=209.264    }}
 +
{{#set: common name=(+)-7-iso-jasmonic acid|iso-jasmonic acid|(3R,7S)-(+)-7-iso-jasmonate}}
 +
{{#set: produced by=RXN-10708}}

Latest revision as of 21:13, 21 March 2018

Metabolite CPD-731

  • smiles:
    • CCC=CCC1(C(=O)CCC1CC([O-])=O)
  • common name:
    • (+)-7-iso-jasmonate
  • inchi key:
    • InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M
  • molecular weight:
    • 209.264
  • Synonym(s):
    • (+)-7-iso-jasmonic acid
    • iso-jasmonic acid
    • (3R,7S)-(+)-7-iso-jasmonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC1(C(=O)CCC1CC([O-])=O)" cannot be used as a page name in this wiki.