Difference between revisions of "Triacylglycerides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerides Triacylglycerides] == * common name: ** a triglyceride * Synonym(s): == Reac...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerides Triacylglycerides] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
 
* common name:
 
* common name:
** pimeloyl-CoA
+
** a triglyceride
* inchi key:
+
** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
+
* molecular weight:
+
** 904.649   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-carboxyhexanoyl-CoA
 
** pimelyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[7KAPSYN-RXN]]
+
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a triglyceride}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589]
+
{{#set: consumed by=TRIACYLGLYCEROL-LIPASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360]
+
* BIGG : pmcoa
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=pimeloyl-CoA}}
+
{{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}}
+
{{#set: molecular weight=904.649    }}
+
{{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}}
+
{{#set: consumed by=7KAPSYN-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite Triacylglycerides

  • common name:
    • a triglyceride
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links