Difference between revisions of "CPDQT-30"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14014 RXN-14014] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * smiles: ** CSCCCCCCCC(=O)C([O-])=O * common name: ** 9-(methylthio)-2-o...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14014 RXN-14014] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCCCC(=O)C([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.17.1.8 EC-1.17.1.8]
+
** 9-(methylthio)-2-oxononanoate
 +
* inchi key:
 +
** InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 217.302   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-(methylthio)-2-oxononanoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-14443]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-18203]]
−
* With common name(s):
+
* [[RXNQT-4174]]
−
** 1 (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 (S)-2,3,4,5-tetrahydrodipicolinate[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_13314]]
+
−
** Source: [[orthology-synechocystis]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942]
+
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
−
* [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04199 R04199]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237169 44237169]
−
** [http://www.genome.jp/dbget-bin/www_bget?R04198 R04198]
+
* KNAPSACK : C00007654
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CSCCCCCCCC(=O)C([O-])=O}}
−
{{#set: ec number=EC-1.17.1.8}}
+
{{#set: common name=9-(methylthio)-2-oxononanoate}}
−
{{#set: gene associated=Tiso_gene_13314}}
+
{{#set: inchi key=InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M}}
−
{{#set: in pathway=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}}
+
{{#set: molecular weight=217.302    }}
−
{{#set: reconstruction category=orthology|manual}}
+
{{#set: common name=9-(methylthio)-2-oxononanoic acid}}
−
{{#set: reconstruction source=manual-primary_network|orthology-synechocystis|orthology-esiliculosus}}
+
{{#set: produced by=RXN-18203|RXNQT-4174}}
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 21:13, 21 March 2018

Metabolite CPDQT-30

  • smiles:
    • CSCCCCCCCC(=O)C([O-])=O
  • common name:
    • 9-(methylthio)-2-oxononanoate
  • inchi key:
    • InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
  • molecular weight:
    • 217.302
  • Synonym(s):
    • 9-(methylthio)-2-oxononanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007654
"CSCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPDQT-30&oldid=46960"