Difference between revisions of "UDP-MANNAC"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10543 == * right end position: ** 8416 * transcription direction: ** NEGATIVE * left end position: ** 6659 * centisome position: ** 78.7860...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] == * smiles: ** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3) |
− | * | + | * common name: |
− | ** | + | ** UDP-N-acetyl-α-D-mannosamine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 605.342 |
* Synonym(s): | * Synonym(s): | ||
+ | ** uridine diphosphate N-acetylmannosamine | ||
+ | ** uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester | ||
+ | ** UDP-acetylmannosamine | ||
+ | ** UDP-ManNAc | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[UDPGLCNACEPIM-RXN]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01170 C01170] |
− | {{#set: | + | * HMDB : HMDB13112 |
− | {{#set: | + | * CHEBI: |
− | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68623 68623] |
+ | * BIGG : uacmam | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245190 25245190] | ||
+ | {{#set: smiles=CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)}} | ||
+ | {{#set: common name=UDP-N-acetyl-α-D-mannosamine}} | ||
+ | {{#set: inchi key=InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L}} | ||
+ | {{#set: molecular weight=605.342 }} | ||
+ | {{#set: common name=uridine diphosphate N-acetylmannosamine|uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester|UDP-acetylmannosamine|UDP-ManNAc}} | ||
+ | {{#set: reversible reaction associated=UDPGLCNACEPIM-RXN}} |
Latest revision as of 21:13, 21 March 2018
Contents
Metabolite UDP-MANNAC
- smiles:
- CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)
- common name:
- UDP-N-acetyl-α-D-mannosamine
- inchi key:
- InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L
- molecular weight:
- 605.342
- Synonym(s):
- uridine diphosphate N-acetylmannosamine
- uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester
- UDP-acetylmannosamine
- UDP-ManNAc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)" cannot be used as a page name in this wiki.