Difference between revisions of "CPD-19487"

Latest revision as of 20:13, 21 March 2018

"CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D15-27-C46-2-ACPs cis-cis-D15-27-C46-2-ACPs] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] ==
+* smiles:
+** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
 * common name:
-** a cis,cis-delta15,27-C46:2-[acp]
+** 3-isopropyl-10-(methylthio)-2-oxodecanoate
+* inchi key:
+** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
+* molecular weight:
+** 274.331
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
+* [[RXN-18201]]
 == Reaction(s) known to produce the compound ==
-* [[RXN1G-607]]
 == Reaction(s) of unknown directionality ==
+* [[RXN-18200]]
 == External links  ==
-{{#set: common name=a cis,cis-delta15,27-C46:2-[acp]}}
+{{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
-{{#set: produced by=RXN1G-607}}
+{{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}}
+{{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}}
+{{#set: molecular weight=274.331    }}
+{{#set: consumed by=RXN-18201}}
+{{#set: reversible reaction associated=RXN-18200}}