Difference between revisions of "DEOXYADENYLATE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * common name: ** sn-glycero...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENYLATE-KINASE-RXN DEOXYADENYLATE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENYLATE-KINASE-RXN DEOXYADENYLATE-KINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.4.13 EC-2.7.4.13] |
− | + | ** [http://enzyme.expasy.org/EC/2.7.4.11 EC-2.7.4.11] | |
− | + | ||
− | * | + | |
− | * | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[DAMP]][c] '''=>''' 1 [[DADP]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 dAMP[c] '''=>''' 1 dADP[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | * [[ | + | * Gene: [[Tiso_gene_805]] |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | * Gene: [[Tiso_gene_5837]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | * Gene: [[Tiso_gene_5388]] |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | == | + | * Gene: [[Tiso_gene_5839]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | * Gene: [[Tiso_gene_12257]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
+ | * Gene: [[Tiso_gene_5387]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_19036]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7224]], purine deoxyribonucleosides salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7224 PWY-7224] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23100 23100] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01547 R01547] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: ec number=EC-2.7.4.13}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.7.4.11}} |
− | + | {{#set: gene associated=Tiso_gene_805|Tiso_gene_5837|Tiso_gene_5388|Tiso_gene_5839|Tiso_gene_12257|Tiso_gene_5387|Tiso_gene_19036}} | |
− | + | {{#set: in pathway=PWY-7224}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-creinhardtii|orthology-synechocystis}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Contents
Reaction DEOXYADENYLATE-KINASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 dAMP[c] => 1 dADP[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_805
- Source: orthology-synechocystis
- Gene: Tiso_gene_5837
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Gene: Tiso_gene_5388
- Source: orthology-synechocystis
- Source: orthology-creinhardtii
- Gene: Tiso_gene_5839
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Gene: Tiso_gene_12257
- Source: orthology-creinhardtii
- Gene: Tiso_gene_5387
- Source: orthology-synechocystis
- Source: orthology-creinhardtii
- Gene: Tiso_gene_19036
- Source: orthology-synechocystis
Pathways
- PWY-7224, purine deoxyribonucleosides salvage: PWY-7224
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links