Difference between revisions of "R06858"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R06858 R06858] == * direction: ** LEFT-TO-RIGHT * common name: ** R611 * Synonym(s): == Reaction F...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R06858 R06858] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
+
** R611
* inchi key:
+
** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
+
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ9-CoA
 
** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17790]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1.0 [[DIHYDROXYNAPHTHOATE]][c] '''=>''' 2.0 [[PROTON]][c] '''+''' 1.0 [[CPD-6947]][c] '''+''' 1.0 [[CARBON-DIOXIDE]][c] '''+''' 1.0 [[PPI]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 phytyl diphosphate[c] '''+''' 1.0 2-carboxy-1,4-naphthoquinol[c] '''=>''' 2.0 H+[c] '''+''' 1.0 demethylphylloquinone[c] '''+''' 1.0 CO2[c] '''+''' 1.0 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10317]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}}
+
{{#set: common name=R611}}
{{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}}
+
{{#set: gene associated=Tiso_gene_10317}}
{{#set: molecular weight=1015.898    }}
+
{{#set: in pathway=}}
{{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: consumed by=RXN-17790}}
+
{{#set: reconstruction source=orthology-synechocystis}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:14, 21 March 2018

Reaction R06858

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R611
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links