Difference between revisions of "Tiso gene 1548"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-is...") |
(Created page with "Category:Gene == Gene Tiso_gene_1548 == * right end position: ** 8755 * transcription direction: ** NEGATIVE * left end position: ** 7610 * centisome position: ** 32.51719...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1548 == |
− | * | + | * right end position: |
− | ** | + | ** 8755 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 7610 |
− | * | + | * centisome position: |
− | ** | + | ** 32.517197 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: right end position=8755}} |
− | {{#set: | + | {{#set: transcription direction=NEGATIVE}} |
− | {{#set: | + | {{#set: left end position=7610}} |
− | {{#set: | + | {{#set: centisome position=32.517197 }} |
− | {{#set: | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} |
− | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_1548
- right end position:
- 8755
- transcription direction:
- NEGATIVE
- left end position:
- 7610
- centisome position:
- 32.517197
- Synonym(s):
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation