Difference between revisions of "Tiso gene 18184"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * common name: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_18184 == * right end position: ** 3170 * transcription direction: ** POSITIVE * left end position: ** 25 * centisome position: ** 0.783208...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18184 == |
− | * | + | * right end position: |
− | ** | + | ** 3170 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 25 |
− | * | + | * centisome position: |
− | ** | + | ** 0.783208 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * | + | |
− | * | + | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3170}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=25}} | |
− | + | {{#set: centisome position=0.783208 }} | |
− | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_18184
- right end position:
- 3170
- transcription direction:
- POSITIVE
- left end position:
- 25
- centisome position:
- 0.783208
- Synonym(s):
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation