Difference between revisions of "CPD-7078"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDUDm ATDUDm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dUDP phosphotransferase, mito...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O |
* common name: | * common name: | ||
| − | ** | + | ** GDP-β-L-gulose |
| + | * inchi key: | ||
| + | ** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L | ||
| + | * molecular weight: | ||
| + | ** 603.329 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-7772]] | |
| − | + | * [[RXN-7771]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * | + | |
| − | * | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925] |
| − | {{#set: | + | {{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}} |
| − | {{#set: | + | {{#set: common name=GDP-β-L-gulose}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}} |
| + | {{#set: molecular weight=603.329 }} | ||
| + | {{#set: reversible reaction associated=RXN-7772|RXN-7771}} | ||
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite CPD-7078
- smiles:
- C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
- common name:
- GDP-β-L-gulose
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
- molecular weight:
- 603.329
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O" cannot be used as a page name in this wiki.
