Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9514 RXN-9514] == * direction: ** LEFT-TO-RIGHT * common name: ** acetoacetyl-[acyl-carrier pro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * common name: *...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9514 RXN-9514] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
 
* common name:
 
* common name:
−
** acetoacetyl-[acyl-carrier protein] reductase
+
** D-mannitol 1-phosphate
−
** polyketide_synthase
+
* inchi key:
−
** 3-oxoacyl-(acyl-carrier-protein)
+
** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
** 260.137   
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** mannitol-1-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[MANNITOL-1-PHOSPHATASE-RXN]]
−
** 1 [[Acetoacetyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Beta-3-hydroxybutyryl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an acetoacetyl-[acp][c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxybutanoyl-[acp][c]
+
* [[MANNPDEHYDROG-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_13394]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_16579]]
+
−
** Source: [[orthology-synechocystis]]
+
−
* Gene: [[Tiso_gene_136]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_135]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_500]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_13083]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-synechocystis]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_10876]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_9885]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_10415]]
+
−
** Source: [[orthology-synechocystis]]
+
−
* Gene: [[Tiso_gene_624]]
+
−
** Source: [[orthology-synechocystis]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 15806-48-1
−
{{#set: common name=acetoacetyl-[acyl-carrier protein] reductase}}
+
* PUBCHEM:
−
{{#set: common name=polyketide_synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341]
−
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
+
* HMDB : HMDB01530
−
{{#set: ec number=EC-2.3.1.86}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.1.85}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644]
−
{{#set: ec number=EC-1.1.1.100}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_13394|Tiso_gene_16579|Tiso_gene_136|Tiso_gene_135|Tiso_gene_500|Tiso_gene_13083|Tiso_gene_10876|Tiso_gene_9885|Tiso_gene_10415|Tiso_gene_624}}
+
** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338]
−
{{#set: in pathway=PWY-5971|PWY-5994|PWY-7388}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381]
−
{{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-synechocystis|orthology-esiliculosus}}
+
* BIGG : mnl1p
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}}
 +
{{#set: common name=D-mannitol 1-phosphate}}
 +
{{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}}
 +
{{#set: molecular weight=260.137    }}
 +
{{#set: common name=mannitol-1-P}}
 +
{{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}}
 +
{{#set: reversible reaction associated=MANNPDEHYDROG-RXN}}

Latest revision as of 20:15, 21 March 2018

Metabolite MANNITOL-1P

  • smiles:
    • C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
  • common name:
    • D-mannitol 1-phosphate
  • inchi key:
    • InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
  • molecular weight:
    • 260.137
  • Synonym(s):
    • mannitol-1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MANNITOL-1P&oldid=47205"