Difference between revisions of "CPD-7496"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA80or ACOA80or] == * direction: ** LEFT-TO-RIGHT * common name: ** Octanoyl-CoA:oxygen 2-oxidore...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA80or ACOA80or] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
 
* common name:
 
* common name:
−
** Octanoyl-CoA:oxygen 2-oxidoreductase
+
** prolycopene
 +
* inchi key:
 +
** InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
 +
* molecular weight:
 +
** 536.882   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7,9,9',7'-tetra-cis-lycopene
 +
** 9,9'-di-cis-ζ-carotene
 +
** 7,9,9',7'-tetracis-lycopene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8042]]
−
** 1.0 [[CPD-196]][x] '''+''' 1.0 [[FAD]][x] '''=>''' 1.0 [[FADH2]][x] '''+''' 1.0 [[CPD0-2108]][x]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-11357]]
−
** 1.0 octanoyl-CoA[x] '''+''' 1.0 FAD[x] '''=>''' 1.0 FADH2[x] '''+''' 1.0 trans-oct-2-enoyl-CoA[x]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-12242]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_16674]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_18566]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_8272]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_17967]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Octanoyl-CoA:oxygen 2-oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10918539 10918539]
−
{{#set: gene associated=Tiso_gene_16674|Tiso_gene_18566|Tiso_gene_8272|Tiso_gene_17967}}
+
* HMDB : HMDB35776
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62466 62466]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15858 C15858]
 +
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C}}
 +
{{#set: common name=prolycopene}}
 +
{{#set: inchi key=InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N}}
 +
{{#set: molecular weight=536.882    }}
 +
{{#set: common name=7,9,9',7'-tetra-cis-lycopene|9,9'-di-cis-ζ-carotene|7,9,9',7'-tetracis-lycopene}}
 +
{{#set: consumed by=RXN-8042}}
 +
{{#set: produced by=RXN-11357}}
 +
{{#set: reversible reaction associated=RXN-12242}}

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-7496

  • smiles:
    • CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
  • common name:
    • prolycopene
  • inchi key:
    • InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
  • molecular weight:
    • 536.882
  • Synonym(s):
    • 7,9,9',7'-tetra-cis-lycopene
    • 9,9'-di-cis-ζ-carotene
    • 7,9,9',7'-tetracis-lycopene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7496&oldid=47222"