Difference between revisions of "Oxidized-adrenal-ferredoxins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLIN VANILLIN] == * smiles: ** COC1(C(=CC=C([CH]=O)C=1)O) * common name: ** vanillin * inch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-adrenal-ferredoxins Oxidized-adrenal-ferredoxins] == * common name: ** an oxidized adr...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-adrenal-ferredoxins Oxidized-adrenal-ferredoxins] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an oxidized adrenodoxin |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an oxidized adrenal ferredoxin |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9843]] |
| + | * [[RXN-9844]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an oxidized adrenodoxin}} | |
| − | + | {{#set: common name=an oxidized adrenal ferredoxin}} | |
| − | + | {{#set: produced by=RXN-9843|RXN-9844}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: produced by= | + | |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite Oxidized-adrenal-ferredoxins
- common name:
- an oxidized adrenodoxin
- Synonym(s):
- an oxidized adrenal ferredoxin
