Difference between revisions of "CPD-13713"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * common n...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O |
* common name: | * common name: | ||
| − | ** | + | ** adenosine 5'-phosphoselenate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 473.174 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** adenylyl-selenate |
| + | ** APSe | ||
| + | ** adenosine phosphoselenate | ||
| + | ** adenylylselenate | ||
| + | ** adenosine-5'-phosphoselenate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12720]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723] |
| + | * HMDB : HMDB04112 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485] |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}} |
| − | {{#set: molecular weight= | + | {{#set: common name=adenosine 5'-phosphoselenate}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}} |
| − | + | {{#set: molecular weight=473.174 }} | |
| − | {{#set: produced by=RXN- | + | {{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}} |
| + | {{#set: produced by=RXN-12720}} | ||
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-13713
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
- common name:
- adenosine 5'-phosphoselenate
- inchi key:
- InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
- molecular weight:
- 473.174
- Synonym(s):
- adenylyl-selenate
- APSe
- adenosine phosphoselenate
- adenylylselenate
- adenosine-5'-phosphoselenate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O" cannot be used as a page name in this wiki.
