Difference between revisions of "Fructofuranose"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * smiles: ** CC(OP([O-])([O-])=O)C([N+]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fructofuranose Fructofuranose] == * common name: ** D-fructofuranose * Synonym(s): == Reaction...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fructofuranose Fructofuranose] ==
* smiles:
+
** CC(OP([O-])([O-])=O)C([N+])C([O-])=O
+
 
* common name:
 
* common name:
** L-threonine 3-O-phosphate
+
** D-fructofuranose
* inchi key:
+
** InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L
+
* molecular weight:
+
** 197.084   
+
 
* Synonym(s):
 
* Synonym(s):
** O-phospho-L-threonine
 
** phosphothreonine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8626]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.4.1.125-RXN]]
 
== External links  ==
 
== External links  ==
* CAS : 1114-81-4
+
{{#set: common name=D-fructofuranose}}
* PUBCHEM:
+
{{#set: reversible reaction associated=2.4.1.125-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688171 36688171]
+
* HMDB : HMDB11185
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C12147 C12147]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58675 58675]
+
* BIGG : thrp
+
{{#set: smiles=CC(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
{{#set: common name=L-threonine 3-O-phosphate}}
+
{{#set: inchi key=InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L}}
+
{{#set: molecular weight=197.084    }}
+
{{#set: common name=O-phospho-L-threonine|phosphothreonine}}
+
{{#set: produced by=RXN-8626}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite Fructofuranose

  • common name:
    • D-fructofuranose
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links