Difference between revisions of "CPD-13851"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14283 CPD-14283] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)CO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** 2-hydroxy-dATP |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 503.152 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate |
− | ** | + | ** 2'-deoxyisoguanosine triphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14290]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897] |
− | {{#set: smiles= | + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}} |
− | {{#set: common name= | + | {{#set: common name=2-hydroxy-dATP}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=503.152 }} |
− | {{#set: common name= | + | {{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}} |
− | + | {{#set: produced by=RXN-14290}} | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-13851
- smiles:
- C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
- common name:
- 2-hydroxy-dATP
- inchi key:
- InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
- molecular weight:
- 503.152
- Synonym(s):
- 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
- 2'-deoxyisoguanosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.