Difference between revisions of "HYDROXY-METHYL-BUTENYL-DIP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-CoAs Long-Chain-Acyl-CoAs] == * common name: ** a long-chain acyl-CoA * Synonym...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == * smiles: ** CC(CO)=CCOP(OP([O-])(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == |
| + | * smiles: | ||
| + | ** CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K | ||
| + | * molecular weight: | ||
| + | ** 259.069 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate |
| − | + | ** HMBDP | |
| − | + | ** 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | |
| − | ** | + | |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ISPH2-RXN]] |
| − | * [[ | + | * [[RXN0-884]] |
| − | * [[ | + | * [[IDS2]] |
| − | * [[ | + | * [[R07219]] |
| + | * [[IDS1]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-882]] |
| − | * [[RXN- | + | * [[RXN-15878]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[HDS]] |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21597501 21597501] |
| − | {{#set: consumed by= | + | * CHEMSPIDER: |
| − | {{#set: produced by= | + | ** [http://www.chemspider.com/Chemical-Structure.10224038.html 10224038] |
| − | {{#set: reversible reaction associated= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=128753 128753] | ||
| + | * BIGG : h2mb4p | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11811 C11811] | ||
| + | {{#set: smiles=CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-]}} | ||
| + | {{#set: common name=(E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}} | ||
| + | {{#set: inchi key=InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K}} | ||
| + | {{#set: molecular weight=259.069 }} | ||
| + | {{#set: common name=(E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate|HMBDP|1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate}} | ||
| + | {{#set: consumed by=ISPH2-RXN|RXN0-884|IDS2|R07219|IDS1}} | ||
| + | {{#set: produced by=RXN0-882|RXN-15878}} | ||
| + | {{#set: reversible reaction associated=HDS}} | ||
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite HYDROXY-METHYL-BUTENYL-DIP
- smiles:
- CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-]
- common name:
- (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
- inchi key:
- InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K
- molecular weight:
- 259.069
- Synonym(s):
- (E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate
- HMBDP
- 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
