Difference between revisions of "GLY-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * smiles: ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY-tRNAs GLY-tRNAs] == * common name: ** a tRNAgly * Synonym(s): == Reaction(s) known to cons...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY-tRNAs GLY-tRNAs] ==
* smiles:
+
** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)
+
 
* common name:
 
* common name:
** primary fluorescent chlorophyll catabolite
+
** a tRNAgly
* inchi key:
+
** InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M
+
* molecular weight:
+
** 626.708   
+
 
* Synonym(s):
 
* Synonym(s):
** pFCC
 
** (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7741]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tRNAgly}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819909 91819909]
+
{{#set: consumed by=GLYCINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58719 58719]
+
{{#set: smiles=CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)}}
+
{{#set: common name=primary fluorescent chlorophyll catabolite}}
+
{{#set: inchi key=InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M}}
+
{{#set: molecular weight=626.708    }}
+
{{#set: common name=pFCC|(82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione}}
+
{{#set: produced by=RXN-7741}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite GLY-tRNAs

  • common name:
    • a tRNAgly
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links