Difference between revisions of "KDO2-LIPID-A"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * common name: ** doc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO2-LIPID-A KDO2-LIPID-A] == * smiles: ** CCCCCCCCCCCCCC(=O)OC(CCCCCCCCCCC)CC(=O)OC4(C(C(OCC1(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO2-LIPID-A KDO2-LIPID-A] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCC(=O)OC(CCCCCCCCCCC)CC(=O)OC4(C(C(OCC1(OC(OP([O-])([O-])=O)C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(O)1))OC(COC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC2(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C2))C3))C4OP([O-])([O-])=O)NC(CC(OC(CCCCCCCCCCC)=O)CCCCCCCCCCC)=O) |
* common name: | * common name: | ||
− | ** | + | ** α-D-Kdo-(2→4)-α-D-Kdo-(2→6)-lipid A |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DIXUKJUHGLIZGU-PPLOIMQXSA-H |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 2232.696 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Re endotoxin |
− | + | ** (Kdo)2-lipid A | |
− | + | ** Kdo2-lipid A | |
− | ** ( | + | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MYRISTOYLACYLTRAN-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820278 91820278] |
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58540 58540] |
− | * | + | * BIGG : lipa |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06026 C06026] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CCCCCCCCCCCCCC(=O)OC(CCCCCCCCCCC)CC(=O)OC4(C(C(OCC1(OC(OP([O-])([O-])=O)C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(O)1))OC(COC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC2(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C2))C3))C4OP([O-])([O-])=O)NC(CC(OC(CCCCCCCCCCC)=O)CCCCCCCCCCC)=O)}} |
− | {{#set: molecular weight= | + | {{#set: common name=α-D-Kdo-(2→4)-α-D-Kdo-(2→6)-lipid A}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=DIXUKJUHGLIZGU-PPLOIMQXSA-H}} |
− | {{#set: produced by= | + | {{#set: molecular weight=2232.696 }} |
− | + | {{#set: common name=Re endotoxin|(Kdo)2-lipid A|Kdo2-lipid A}} | |
+ | {{#set: produced by=MYRISTOYLACYLTRAN-RXN}} |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite KDO2-LIPID-A
- smiles:
- CCCCCCCCCCCCCC(=O)OC(CCCCCCCCCCC)CC(=O)OC4(C(C(OCC1(OC(OP([O-])([O-])=O)C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(O)1))OC(COC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC2(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C2))C3))C4OP([O-])([O-])=O)NC(CC(OC(CCCCCCCCCCC)=O)CCCCCCCCCCC)=O)
- common name:
- α-D-Kdo-(2→4)-α-D-Kdo-(2→6)-lipid A
- inchi key:
- InChIKey=DIXUKJUHGLIZGU-PPLOIMQXSA-H
- molecular weight:
- 2232.696
- Synonym(s):
- Re endotoxin
- (Kdo)2-lipid A
- Kdo2-lipid A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCC(=O)OC(CCCCCCCCCCC)CC(=O)OC4(C(C(OCC1(OC(OP([O-])([O-])=O)C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(O)1))OC(COC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC2(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C2))C3))C4OP([O-])([O-])=O)NC(CC(OC(CCCCCCCCCCC)=O)CCCCCCCCCCC)=O)" cannot be used as a page name in this wiki.