Difference between revisions of "DCTP"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6057 == * right end position: ** 1882 * transcription direction: ** NEGATIVE * left end position: ** 291 * centisome position: ** 2.3073263...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** dCTP |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 463.127 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2'-deoxycytidine-5'-triphosphate | ||
| + | ** deoxycytidine-triphosphate | ||
| + | ** deoxy-CTP | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-14198]] |
| − | * | + | * [[DCTP-PYROPHOSPHATASE-RXN]] |
| − | *** | + | * [[DCTCP]] |
| − | == | + | * [[RME255]] |
| + | * [[DCTUP]] | ||
| + | * [[RXN-14216]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[ATDCD]] | ||
| + | * [[DCDPKIN-RXN]] | ||
| + | * [[ATDCDm]] | ||
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 2056-98-6 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] |
| − | {{#set: | + | * HMDB : HMDB00998 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ||
| + | * BIGG : dctp | ||
| + | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| + | {{#set: common name=dCTP}} | ||
| + | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} | ||
| + | {{#set: molecular weight=463.127 }} | ||
| + | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | ||
| + | {{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}} | ||
| + | {{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}} | ||
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- common name:
- dCTP
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- molecular weight:
- 463.127
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
