Difference between revisions of "CPDQT-4"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_178 == * right end position: ** 26768 * transcription direction: ** POSITIVE * left end position: ** 24658 * centisome position: ** 41.3052...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * common name: ** &b...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) |
− | * | + | * common name: |
− | ** | + | ** β-L-galactose 1-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXNQT-4142]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}} | ||
+ | {{#set: common name=β-L-galactose 1-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: consumed by=RXNQT-4142}} |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPDQT-4
- smiles:
- C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
- common name:
- β-L-galactose 1-phosphate
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.