Difference between revisions of "Long-linear-glucans"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-linear-glucans Long-linear-glucans] == * common name: ** a long-linear glucan * Synonym(s)...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-linear-glucans Long-linear-glucans] ==
* smiles:
+
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
 
* common name:
 
* common name:
** dCTP
+
** a long-linear glucan
* inchi key:
+
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
+
* molecular weight:
+
** 463.127   
+
 
* Synonym(s):
 
* Synonym(s):
** 2'-deoxycytidine-5'-triphosphate
 
** deoxycytidine-triphosphate
 
** deoxy-CTP
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14198]]
 
* [[DCTP-PYROPHOSPHATASE-RXN]]
 
* [[DCTCP]]
 
* [[RME255]]
 
* [[DCTUP]]
 
* [[RXN-14216]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDCD]]
 
* [[DCDPKIN-RXN]]
 
* [[ATDCDm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-1826]]
 
== External links  ==
 
== External links  ==
* CAS : 2056-98-6
+
{{#set: common name=a long-linear glucan}}
* PUBCHEM:
+
{{#set: reversible reaction associated=RXN-1826}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
+
* HMDB : HMDB00998
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
+
* BIGG : dctp
+
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: common name=dCTP}}
+
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
+
{{#set: molecular weight=463.127    }}
+
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
+
{{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}}
+
{{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}}
+

Latest revision as of 20:18, 21 March 2018

Metabolite Long-linear-glucans

  • common name:
    • a long-linear glucan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links