Difference between revisions of "G3P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] == * smiles: ** C(=O)C=CC1(C=CC(O)=CC=1) * common name: ** 4-cou...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] * common name: ** 3-phospho-D-glycera...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == |
* smiles: | * smiles: | ||
| − | ** C(=O) | + | ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 3-phospho-D-glycerate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OSJPPGNTCRNQQC-UWTATZPHSA-K |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 183.034 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-phospho-(R)-glycerate |
| − | ** | + | ** 3-phospho-D-glyceric acid |
| + | ** 3-P-D-glycerate | ||
| + | ** D-glycerate-3-P | ||
| + | ** D-glycerate 3-phosphate | ||
| + | ** 3-phosphoglycerate | ||
| + | ** D-3-phosphoglycerate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ACPh]] |
| + | * [[GLY3KIN-RXN]] | ||
| + | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[3PGAREARR-RXN]] | ||
| + | * [[PGLYCDEHYDROG-RXN]] | ||
| + | * [[3PG_pi_thr]] | ||
| + | * [[RXN-15513]] | ||
| + | * [[RXN-15511]] | ||
| + | * [[PHOSGLYPHOS-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 820-11-1 | ||
| + | * BIGG : 3pg | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245548 25245548] |
| − | * HMDB : | + | * HMDB : HMDB60180 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00197 C00197] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58272 58272] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC58272 |
| − | {{#set: smiles=C(=O) | + | {{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: common name=3-phospho-D-glycerate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=OSJPPGNTCRNQQC-UWTATZPHSA-K}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=183.034 }} |
| − | {{#set: common name= | + | {{#set: common name=3-phospho-(R)-glycerate|3-phospho-D-glyceric acid|3-P-D-glycerate|D-glycerate-3-P|D-glycerate 3-phosphate|3-phosphoglycerate|D-3-phosphoglycerate}} |
| − | {{#set: | + | {{#set: produced by=ACPh|GLY3KIN-RXN|RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN}} |
| − | {{#set: | + | {{#set: reversible reaction associated=3PGAREARR-RXN|PGLYCDEHYDROG-RXN|3PG_pi_thr|RXN-15513|RXN-15511|PHOSGLYPHOS-RXN}} |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite G3P
- smiles:
- C(OP(=O)([O-])[O-])C(O)C(=O)[O-]
- common name:
- 3-phospho-D-glycerate
- inchi key:
- InChIKey=OSJPPGNTCRNQQC-UWTATZPHSA-K
- molecular weight:
- 183.034
- Synonym(s):
- 3-phospho-(R)-glycerate
- 3-phospho-D-glyceric acid
- 3-P-D-glycerate
- D-glycerate-3-P
- D-glycerate 3-phosphate
- 3-phosphoglycerate
- D-3-phosphoglycerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 820-11-1
- BIGG : 3pg
- PUBCHEM:
- HMDB : HMDB60180
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58272
"C(OP(=O)([O-])[O-])C(O)C(=O)[O-" cannot be used as a page name in this wiki.
