Difference between revisions of "CPD-7424"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * common name: ** (2S)-2-iso...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == * smiles: ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == |
* smiles: | * smiles: | ||
− | ** CC(C | + | ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3) |
* common name: | * common name: | ||
− | ** | + | ** 9'-cis-neoxanthin |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 600.88 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 9cNeox |
+ | ** 9c-neoxanthin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-698]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282217 5282217] |
− | {{#set: smiles=CC(C | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.10392237.html 10392237] |
− | {{#set: inchi key=InChIKey= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35306 35306] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13431 C13431] |
− | + | {{#set: smiles=CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)}} | |
− | + | {{#set: common name=9'-cis-neoxanthin}} | |
+ | {{#set: inchi key=InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N}} | ||
+ | {{#set: molecular weight=600.88 }} | ||
+ | {{#set: common name=9cNeox|9c-neoxanthin}} | ||
+ | {{#set: consumed by=RXN-698}} |
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite CPD-7424
- smiles:
- CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
- common name:
- 9'-cis-neoxanthin
- inchi key:
- InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
- molecular weight:
- 600.88
- Synonym(s):
- 9cNeox
- 9c-neoxanthin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)" cannot be used as a page name in this wiki.