Difference between revisions of "RXNQT-4142"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4142 RXNQT-4142] == * direction: ** LEFT-TO-RIGHT * common name: ** possible_l-galactose-1-ph...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4142 RXNQT-4142] ==
−
* smiles:
+
* direction:
−
** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** possible_l-galactose-1-phosphate_phosphatase
−
* inchi key:
+
* ec number:
−
** InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
+
** [http://enzyme.expasy.org/EC/3.1.3.93 EC-3.1.3.93]
−
* molecular weight:
+
−
** 842.848   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-15680]]
+
** 1 [[CPDQT-4]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[L-Galactopyranose]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 β-L-galactose 1-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 L-galactopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11614]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10754]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_15599]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657797 90657797]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26349 26349]
−
{{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
* LIGAND-RXN:
−
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07674 R07674]
−
{{#set: inchi key=InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=842.848    }}
+
{{#set: common name=possible_l-galactose-1-phosphate_phosphatase}}
−
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: ec number=EC-3.1.3.93}}
−
{{#set: produced by=RXN-15680}}
+
{{#set: gene associated=Tiso_gene_11614|Tiso_gene_10754|Tiso_gene_15599}}
 +
{{#set: in pathway=PWY-882}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:19, 21 March 2018

Reaction RXNQT-4142

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • possible_l-galactose-1-phosphate_phosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 β-L-galactose 1-phosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 L-galactopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
    • 6 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXNQT-4142&oldid=47766"