Difference between revisions of "Tiso gene 4321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9923 CPD-9923] == * smiles: ** C1(=CC(O)C(C(=O)[O-])C(=C1)C(=O)CCC(=O)[O-]) * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_4321 == * Synonym(s): == Reactions associated == * Reaction: 2.4.1.223-RXN ** Source: orthology-esiliculosus == Pathways associate...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4321 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.4.1.223-RXN]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-6558]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.4.1.223-RXN}} | |
− | + | {{#set: pathway associated=PWY-6558}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 21:19, 21 March 2018
Gene Tiso_gene_4321
- Synonym(s):
Reactions associated
- Reaction: 2.4.1.223-RXN
- Source: orthology-esiliculosus