Difference between revisions of "2.7.10.1-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * common name: ** 4-methyl-3-o...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.10.1-RXN 2.7.10.1-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.10.1-RXN 2.7.10.1-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.10.2 EC-2.7.10.2] |
− | * | + | ** [http://enzyme.expasy.org/EC/2.7.12.1 EC-2.7.12.1] |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.10.1 EC-2.7.10.1] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Protein-Tyrosines]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-tyrosine-phosphates]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a [protein]-L-tyrosine[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 a [protein]-L-tyrosine phosphate[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_5584]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_1492]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_1810]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_2393]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10356]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9800]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6071]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_17980]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_18523]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_17047]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10355]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14940]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14941]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_15652]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_12229]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02584 R02584] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: common name= | + | {{#set: common name=ORF}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.10.2}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.12.1}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.10.1}} |
+ | {{#set: gene associated=Tiso_gene_5584|Tiso_gene_1492|Tiso_gene_1810|Tiso_gene_2393|Tiso_gene_10356|Tiso_gene_9800|Tiso_gene_6071|Tiso_gene_17980|Tiso_gene_18523|Tiso_gene_17047|Tiso_gene_10355|Tiso_gene_14940|Tiso_gene_14941|Tiso_gene_15652|Tiso_gene_12229}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:19, 21 March 2018
Contents
Reaction 2.7.10.1-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Protein-Tyrosines[c] + 1 ATP[c] => 1 PROTON[c] + 1 Protein-tyrosine-phosphates[c] + 1 ADP[c]
- With common name(s):
- 1 a [protein]-L-tyrosine[c] + 1 ATP[c] => 1 H+[c] + 1 a [protein]-L-tyrosine phosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5584
- Source: orthology-esiliculosus
- Gene: Tiso_gene_1492
- Source: orthology-esiliculosus
- Gene: Tiso_gene_1810
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2393
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10356
- Source: orthology-esiliculosus
- Gene: Tiso_gene_9800
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6071
- Source: orthology-esiliculosus
- Gene: Tiso_gene_17980
- Source: orthology-esiliculosus
- Gene: Tiso_gene_18523
- Source: orthology-esiliculosus
- Gene: Tiso_gene_17047
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10355
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14940
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14941
- Source: orthology-esiliculosus
- Gene: Tiso_gene_15652
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12229
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: