Difference between revisions of "RXN66-353"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-353 RXN66-353] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-beta_hydroxysteroid_dehyd...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-353 RXN66-353] ==
−
* smiles:
+
* direction:
−
** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** OPC8-3-ketoacyl-CoA
+
** 3-beta_hydroxysteroid_dehydrogenase_isomerase
−
* inchi key:
+
** ORF
−
** InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/1.1.1.145 EC-1.1.1.145]
−
** 1053.904   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10699]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PREGNENOLONE]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD66-28]][c]
−
* [[RXN-10698]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 pregnenolone[c] '''+''' 1 NAD+[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 pregn-5-ene-3,20-dione[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18774]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2957]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_897]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_11016]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7299]], progesterone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7299 PWY-7299]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237200 44237200]
+
{{#set: common name=3-beta_hydroxysteroid_dehydrogenase_isomerase}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: common name=ORF}}
−
{{#set: common name=OPC8-3-ketoacyl-CoA}}
+
{{#set: ec number=EC-1.1.1.145}}
−
{{#set: inchi key=InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J}}
+
{{#set: gene associated=Tiso_gene_18774|Tiso_gene_2957|Tiso_gene_897|Tiso_gene_11016}}
−
{{#set: molecular weight=1053.904    }}
+
{{#set: in pathway=PWY-7299}}
−
{{#set: consumed by=RXN-10699}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: produced by=RXN-10698}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:19, 21 March 2018

Reaction RXN66-353

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-beta_hydroxysteroid_dehydrogenase_isomerase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 pregnenolone[c] + 1 NAD+[c] => 1 NADH[c] + 1 H+[c] + 1 pregn-5-ene-3,20-dione[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7299, progesterone biosynthesis: PWY-7299
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-353&oldid=47838"