Difference between revisions of "CPD-14950"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * c...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == |
* smiles: | * smiles: | ||
− | ** | + | ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) |
* common name: | * common name: | ||
− | ** | + | ** 3-O-methylkaempferol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 300.267 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** kaempferol 3-methyl ether |
− | ** | + | ** 3-Methoxyapigenin |
− | + | ** isokaempferide | |
− | ** | + | ** 3-methylkaempferol |
− | + | ||
− | ** 3- | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13935]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902] |
− | {{#set: common name= | + | {{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=3-O-methylkaempferol}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}} |
− | {{#set: common name= | + | {{#set: molecular weight=300.267 }} |
− | {{#set: | + | {{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}} |
+ | {{#set: produced by=RXN-13935}} |
Latest revision as of 20:20, 21 March 2018
Contents
Metabolite CPD-14950
- smiles:
- COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
- common name:
- 3-O-methylkaempferol
- inchi key:
- InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
- molecular weight:
- 300.267
- Synonym(s):
- kaempferol 3-methyl ether
- 3-Methoxyapigenin
- isokaempferide
- 3-methylkaempferol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links