Difference between revisions of "RXN-10604"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * co...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10604 RXN-10604] == * direction: ** LEFT-TO-RIGHT * common name: ** type_i_iodothyronine_deiodi...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10604 RXN-10604] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** type_i_iodothyronine_deiodinase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.21.99.4 EC-1.21.99.4] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[CPD-10813]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-387]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[CPD-11395]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 3,3',5'-triiodo-L-thyronine[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 H+[c] '''+''' 1 iodide[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 3,3'-diiodothyronine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_20481]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-6260]], thyroid hormone metabolism I (via deiodination): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6260 PWY-6260] | ||
| + | ** '''3''' reactions found over '''12''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=type_i_iodothyronine_deiodinase}} | |
| − | + | {{#set: ec number=EC-1.21.99.4}} | |
| − | + | {{#set: gene associated=Tiso_gene_20481}} | |
| − | + | {{#set: in pathway=PWY-6260}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:20, 21 March 2018
Contents
Reaction RXN-10604
- direction:
- LEFT-TO-RIGHT
- common name:
- type_i_iodothyronine_deiodinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 3,3',5'-triiodo-L-thyronine[c] + 1 a reduced electron acceptor[c] => 1 H+[c] + 1 iodide[c] + 1 an oxidized electron acceptor[c] + 1 3,3'-diiodothyronine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_20481
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6260, thyroid hormone metabolism I (via deiodination): PWY-6260
- 3 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
