Difference between revisions of "RXN-15117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * common name: ** 7-methyl...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15117 RXN-15117] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15117 RXN-15117] ==
−
* smiles:
+
* direction:
−
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 7-methylurate
+
** [http://enzyme.expasy.org/EC/2.4.1.315 EC-2.4.1.315]
−
* inchi key:
+
−
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 182.138   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-methyluric acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11521]]
+
** 1 [[CPD-12575]][c] '''+''' 1 [[D-Glucosyl-12-diacyl-glycerols]][c] '''=>''' 1 [[diacyl-3-O-glucl-1-6-gluc-sn-glycerol]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP-α-D-glucose[c] '''+''' 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol[c] '''=>''' 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol[c] '''+''' 1 UDP[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3385]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_412]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_15372]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12341]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19034]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_10734]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_7966]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_9428]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_15050]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_11792]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_17894]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_10863]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817]
 +
** '''7''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
+
{{#set: ec number=EC-2.4.1.315}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_3385|Tiso_gene_412|Tiso_gene_15372|Tiso_gene_12341|Tiso_gene_19034|Tiso_gene_10734|Tiso_gene_7966|Tiso_gene_9428|Tiso_gene_15050|Tiso_gene_11792|Tiso_gene_17894|Tiso_gene_10863}}
−
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
+
{{#set: in pathway=PWY-7817}}
−
* HMDB : HMDB11107
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-athaliana}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
+
−
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
+
−
{{#set: common name=7-methylurate}}
+
−
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=182.138    }}
+
−
{{#set: common name=7-methyluric acid}}
+
−
{{#set: produced by=RXN-11521}}
+

Latest revision as of 20:20, 21 March 2018

Reaction RXN-15117

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7817, type I lipoteichoic acid biosynthesis (S. aureus): PWY-7817
    • 7 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15117&oldid=47931"