Difference between revisions of "CPD-16491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP-DEAMINASE-RXN AMP-DEAMINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** amp_deamina...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * common name: ** 2,6-dia...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP-DEAMINASE-RXN AMP-DEAMINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
 
* common name:
 
* common name:
−
** amp_deaminase
+
** 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.4.17 EC-3.5.4.17]
+
** InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
−
** [http://enzyme.expasy.org/EC/3.5.4.6 EC-3.5.4.6]
+
* molecular weight:
 +
** 183.169   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[IMP]][c] '''+''' 1 [[AMMONIUM]][c]
+
* [[3.2.2.23-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 H2O[c] '''=>''' 1 IMP[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_1778]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
+
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIGAND-CPD:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14777 14777]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04744 C04744]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00181 R00181]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28643 28643]
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P10759 P10759]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546]
−
** [http://www.uniprot.org/uniprot/Q02356 Q02356]
+
* HMDB : HMDB11657
−
** [http://www.uniprot.org/uniprot/P23109 P23109]
+
{{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}}
−
** [http://www.uniprot.org/uniprot/P15274 P15274]
+
{{#set: common name=2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine}}
−
** [http://www.uniprot.org/uniprot/Q7M3H8 Q7M3H8]
+
{{#set: inchi key=InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N}}
−
** [http://www.uniprot.org/uniprot/Q01433 Q01433]
+
{{#set: molecular weight=183.169    }}
−
** [http://www.uniprot.org/uniprot/Q01432 Q01432]
+
{{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: produced by=3.2.2.23-RXN}}
−
{{#set: common name=amp_deaminase}}
+
−
{{#set: ec number=EC-3.5.4.17}}
+
−
{{#set: ec number=EC-3.5.4.6}}
+
−
{{#set: gene associated=Tiso_gene_1778}}
+
−
{{#set: in pathway=PWY-6596}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-16491

  • smiles:
    • CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
  • common name:
    • 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
  • inchi key:
    • InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
  • molecular weight:
    • 183.169
  • Synonym(s):
    • N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-16491&oldid=47996"