Difference between revisions of "CPD-9871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOx NODOx] == * direction: ** LEFT-TO-RIGHT * common name: ** nitric oxide, NADH2:oxygen oxidored...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOx NODOx] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C
 
* common name:
 
* common name:
−
** nitric oxide, NADH2:oxygen oxidoreductase
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
 +
* inchi key:
 +
** InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N
 +
* molecular weight:
 +
** 835.347   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol
 +
** 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2.0 [[OXYGEN-MOLECULE]][c] '''+''' 2.0 [[NITRIC-OXIDE]][c] '''+''' 1.0 [[NADH]][c] '''=>''' 2.0 [[NITRATE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NAD]][c]
+
* [[RXN-9235]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2.0 oxygen[c] '''+''' 2.0 nitric oxide[c] '''+''' 1.0 NADH[c] '''=>''' 2.0 nitrate[c] '''+''' 1.0 H+[c] '''+''' 1.0 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_4015]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=nitric oxide, NADH2:oxygen oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986092 50986092]
−
{{#set: gene associated=Tiso_gene_4015}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64181 64181]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C}}
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: common name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N}}
 +
{{#set: molecular weight=835.347    }}
 +
{{#set: common name=6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol|6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol}}
 +
{{#set: produced by=RXN-9235}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-9871

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C
  • common name:
    • 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
  • inchi key:
    • InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N
  • molecular weight:
    • 835.347
  • Synonym(s):
    • 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol
    • 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9871&oldid=48025"