Difference between revisions of "3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN 3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN] == * direction: ** LEF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN 3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** enoyl-_hydratase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.2.4 EC-3.1.2.4] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-12173]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-12175]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (S)-3-hydroxy-isobutanoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 coenzyme A[c] '''+''' 1 H+[c] '''+''' 1 (S)-3-hydroxy-isobutanoate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2224]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20888 20888] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03352 R03352] |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05064 R05064] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=enoyl-_hydratase}} | |
− | + | {{#set: ec number=EC-3.1.2.4}} | |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_2224}} |
− | {{#set: | + | {{#set: in pathway=VALDEG-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|orthology-creinhardtii|annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + |
Latest revision as of 21:21, 21 March 2018
Contents
Reaction 3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- enoyl-_hydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (S)-3-hydroxy-isobutanoyl-CoA[c] + 1 H2O[c] => 1 coenzyme A[c] + 1 H+[c] + 1 (S)-3-hydroxy-isobutanoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2224
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
- VALDEG-PWY, L-valine degradation I: VALDEG-PWY
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links