Difference between revisions of "Tiso gene 5365"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * common name: ** spermine * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_5365 == * right end position: ** 3112 * transcription direction: ** NEGATIVE * left end position: ** 90 * centisome position: ** 0.6637657...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5365 == |
− | * | + | * right end position: |
− | ** | + | ** 3112 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 90 |
− | * | + | * centisome position: |
− | ** | + | ** 0.6637657 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[N-ACETYLTRANSFER-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-6948]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5154]] | ||
+ | * [[GLUTORN-PWY]] | ||
+ | * [[ARGSYNBSUB-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3112}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=90}} | |
− | + | {{#set: centisome position=0.6637657 }} | |
− | + | {{#set: reaction associated=GLUTAMATE-N-ACETYLTRANSFERASE-RXN|N-ACETYLTRANSFER-RXN|RXN0-6948}} | |
− | + | {{#set: pathway associated=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:21, 21 March 2018
Gene Tiso_gene_5365
- right end position:
- 3112
- transcription direction:
- NEGATIVE
- left end position:
- 90
- centisome position:
- 0.6637657
- Synonym(s):
Reactions associated
- Reaction: GLUTAMATE-N-ACETYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: N-ACETYLTRANSFER-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN0-6948
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation