Difference between revisions of "Behenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * common name: ** 2,6-dia...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Behenoyl-ACPs Behenoyl-ACPs] == * common name: ** a behenoyl-[acp] * Synonym(s): == Reaction(s...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Behenoyl-ACPs Behenoyl-ACPs] ==
* smiles:
+
** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
+
 
* common name:
 
* common name:
** 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
+
** a behenoyl-[acp]
* inchi key:
+
** InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
+
* molecular weight:
+
** 183.169   
+
 
* Synonym(s):
 
* Synonym(s):
** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-499]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.2.23-RXN]]
+
* [[RXN1G-488]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a behenoyl-[acp]}}
** [http://www.genome.jp/dbget-bin/www_bget?C04744 C04744]
+
{{#set: consumed by=RXN1G-499}}
* CHEBI:
+
{{#set: produced by=RXN1G-488}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28643 28643]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546]
+
* HMDB : HMDB11657
+
{{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}}
+
{{#set: common name=2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine}}
+
{{#set: inchi key=InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N}}
+
{{#set: molecular weight=183.169    }}
+
{{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}}
+
{{#set: produced by=3.2.2.23-RXN}}
+

Latest revision as of 20:21, 21 March 2018

Metabolite Behenoyl-ACPs

  • common name:
    • a behenoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a behenoyl-[acp" cannot be used as a page name in this wiki.