Difference between revisions of "CPD-11665"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] == * smiles: ** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * common name: **...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
 
* smiles:
 
* smiles:
−
** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
 
* common name:
 
* common name:
−
** (5Z)-dodecenoyl-CoA
+
** serotonin O-sulfate
 
* inchi key:
 
* inchi key:
−
** InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J
+
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
 
* molecular weight:
 
* molecular weight:
−
** 943.792    
+
** 256.276    
 
* Synonym(s):
 
* Synonym(s):
−
** 12:1-Δ5-CoA
+
** 5-hydroxytryptamine O-sulfate
−
** cis-5-tetradecenoyl-CoA
+
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
−
** 12:1(n-7)-CoA
+
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
−
** (5Z)-tetradec-5-enoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17796]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17795]]
+
* [[RXN-10777]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* PUBCHEM:
−
{{#set: common name=(5Z)-dodecenoyl-CoA}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
−
{{#set: inchi key=InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J}}
+
* CHEMSPIDER:
−
{{#set: molecular weight=943.792   }}
+
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
−
{{#set: common name=12:1-Δ5-CoA|cis-5-tetradecenoyl-CoA|12:1(n-7)-CoA|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
−
{{#set: consumed by=RXN-17796}}
+
{{#set: common name=serotonin O-sulfate}}
−
{{#set: produced by=RXN-17795}}
+
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=256.276   }}
 +
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
 +
{{#set: produced by=RXN-10777}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-11665

  • smiles:
    • C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
  • common name:
    • serotonin O-sulfate
  • inchi key:
    • InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
  • molecular weight:
    • 256.276
  • Synonym(s):
    • 5-hydroxytryptamine O-sulfate
    • 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
    • 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11665&oldid=48125"