Difference between revisions of "3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * common name:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN] == * direction: ** L...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyisobutyrate_mitochondrial |
− | * | + | ** 3-hydroxyisobutyrate_dehydrogenase |
− | ** | + | ** uncharacterized_oxidoreductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.31 EC-1.1.1.31] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[CPD-12175]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CH3-MALONATE-S-ALD]][c] '''+''' 1 [[NADH]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-isobutanoate[c] '''=>''' 1 H+[c] '''+''' 1 (S)-methylmalonate-semialdehyde[c] '''+''' 1 NADH[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_7107]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_19772]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5857]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_19592]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_19590]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_19771]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02047 R02047] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P29266 P29266] |
− | * | + | ** [http://www.uniprot.org/uniprot/P28811 P28811] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q8XAE4 Q8XAE4] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q55702 Q55702] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9XTI0 Q9XTI0] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www. | + | {{#set: common name=3-hydroxyisobutyrate_mitochondrial}} |
− | + | {{#set: common name=3-hydroxyisobutyrate_dehydrogenase}} | |
− | {{#set: | + | {{#set: common name=uncharacterized_oxidoreductase}} |
− | {{#set: common name= | + | {{#set: ec number=EC-1.1.1.31}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_7107|Tiso_gene_19772|Tiso_gene_5857|Tiso_gene_19592|Tiso_gene_19590|Tiso_gene_19771}} |
− | {{#set: | + | {{#set: in pathway=VALDEG-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus|annotation-experimental_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:22, 21 March 2018
Contents
Reaction 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxyisobutyrate_mitochondrial
- 3-hydroxyisobutyrate_dehydrogenase
- uncharacterized_oxidoreductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 CPD-12175[c] => 1 PROTON[c] + 1 CH3-MALONATE-S-ALD[c] + 1 NADH[c]
- With common name(s):
- 1 NAD+[c] + 1 (S)-3-hydroxy-isobutanoate[c] => 1 H+[c] + 1 (S)-methylmalonate-semialdehyde[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7107
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19772
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5857
- Source: orthology-athaliana
- Source: orthology-creinhardtii
- Gene: Tiso_gene_19592
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Gene: Tiso_gene_19590
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19771
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- VALDEG-PWY, L-valine degradation I: VALDEG-PWY
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links