Difference between revisions of "TIGLYLCOA-HYDROXY-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * common...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TIGLYLCOA-HYDROXY-RXN TIGLYLCOA-HYDROXY-RXN] == * direction: ** REVERSIBLE * common name: ** Tiglyl...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TIGLYLCOA-HYDROXY-RXN TIGLYLCOA-HYDROXY-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** Tiglyl-CoA hydratase |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17] | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[2-METHYL-3-HYDROXY-BUTYRYL-COA]][c] '''<=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-1083]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA[c] '''<=>''' 1 H2O[c] '''+''' 1 (E)-2-methylcrotonoyl-CoA[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * Gene: [[Tiso_gene_14257]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
+ | * Gene: [[Tiso_gene_14262]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6885]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5857]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_16145]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5109]], 2-methylbutanoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5109 PWY-5109] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[ILEUDEG-PWY]], L-isoleucine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ILEUDEG-PWY ILEUDEG-PWY] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31119 31119] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04204 R04204] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | * LIGAND- | + | {{#set: common name=Tiglyl-CoA hydratase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-4.2.1.17}} |
− | + | {{#set: gene associated=Tiso_gene_14257|Tiso_gene_14262|Tiso_gene_6885|Tiso_gene_5857|Tiso_gene_16145}} | |
− | + | {{#set: in pathway=PWY-5109|ILEUDEG-PWY}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:22, 21 March 2018
Contents
Reaction TIGLYLCOA-HYDROXY-RXN
- direction:
- REVERSIBLE
- common name:
- Tiglyl-CoA hydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-METHYL-3-HYDROXY-BUTYRYL-COA[c] <=> 1 WATER[c] + 1 CPD-1083[c]
- With common name(s):
- 1 (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA[c] <=> 1 H2O[c] + 1 (E)-2-methylcrotonoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14257
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14262
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6885
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5857
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Gene: Tiso_gene_16145
- Source: orthology-esiliculosus
Pathways
- PWY-5109, 2-methylbutanoate biosynthesis: PWY-5109
- 2 reactions found over 6 reactions in the full pathway
- ILEUDEG-PWY, L-isoleucine degradation I: ILEUDEG-PWY
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links