Difference between revisions of "RXNI-2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNI-2 RXNI-2] == * direction: ** REVERSIBLE * common name: ** succinyl-_:3-ketoacid-coenzyme_a_tra...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNI-2 RXNI-2] ==
* smiles:
+
* direction:
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
+
** REVERSIBLE
 
* common name:
 
* common name:
** molybdopterin adenine dinucleotide
+
** succinyl-_:3-ketoacid-coenzyme_a_transferase_mitochondrial
* inchi key:
+
* ec number:
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
** [http://enzyme.expasy.org/EC/2.8.3.5 EC-2.8.3.5]
* molecular weight:
+
** 721.529   
+
 
* Synonym(s):
 
* Synonym(s):
** adenylated molybdopterin
 
** H2Dtpp-mADP
 
** molybdopterin-AMP
 
** adenylyl-molybdopterin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-8348]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[3-KETOBUTYRATE]][c] '''+''' 1 [[SUC-COA]][c] '''<=>''' 1 [[SUC]][c] '''+''' 1 [[ACETOACETYL-COA]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 acetoacetate[c] '''+''' 1 succinyl-CoA[c] '''<=>''' 1 succinate[c] '''+''' 1 acetoacetyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6754]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[REDCITCYC]], TCA cycle VIII (helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY66-368]], ketolysis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25480 25480]
* CHEBI:
+
* LIGAND-RXN:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00410 R00410]
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
+
{{#set: direction=REVERSIBLE}}
{{#set: common name=molybdopterin adenine dinucleotide}}
+
{{#set: common name=succinyl-_:3-ketoacid-coenzyme_a_transferase_mitochondrial}}
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: ec number=EC-2.8.3.5}}
{{#set: molecular weight=721.529    }}
+
{{#set: gene associated=Tiso_gene_6754}}
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
{{#set: in pathway=REDCITCYC|PWY66-368}}
{{#set: consumed by=RXN-8348}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:23, 21 March 2018

Reaction RXNI-2

  • direction:
    • REVERSIBLE
  • common name:
    • succinyl-_:3-ketoacid-coenzyme_a_transferase_mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • REDCITCYC, TCA cycle VIII (helicobacter): REDCITCYC
    • 6 reactions found over 9 reactions in the full pathway
  • PWY66-368, ketolysis: PWY66-368
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links