Difference between revisions of "R-3-hydroxymyristoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * common name: ** tributy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxymyristoyl-ACPs R-3-hydroxymyristoyl-ACPs] == * common name: ** a (3R)-3-hydroxymyris...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxymyristoyl-ACPs R-3-hydroxymyristoyl-ACPs] ==
−
* smiles:
+
−
** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
+
 
* common name:
 
* common name:
−
** tributyrin
+
** a (3R)-3-hydroxymyristoyl-[acp]
−
* inchi key:
+
−
** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 302.367   
+
 
* Synonym(s):
 
* Synonym(s):
−
** butyryl triglyceride
+
** a β-hydroxymyristoyl-[acp]
−
** butanoic acid, 1,2,3-propanetriyl ester
+
** a (3R)-3-hydroxymyristoyl-[acyl-carrier protein]
−
** 1,2,3-tributyrylglycerol
+
** an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein]
−
** tributin
+
−
** tributyrinine
+
−
** glycerol tributyrate
+
−
** glyceryl tributyrate
+
−
** butyrin
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12086]]
+
* [[RXN-9537]]
 +
* [[UDPNACETYLGLUCOSAMACYLTRANS-RXN]]
 +
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9536]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a (3R)-3-hydroxymyristoyl-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870]
+
{{#set: common name=a β-hydroxymyristoyl-[acp]|a (3R)-3-hydroxymyristoyl-[acyl-carrier protein]|an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein]}}
−
* CHEMSPIDER:
+
{{#set: consumed by=RXN-9537|UDPNACETYLGLUCOSAMACYLTRANS-RXN|UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN}}
−
** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665]
+
{{#set: produced by=RXN-9536}}
−
* HMDB : HMDB31094
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050]
+
−
{{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}}
+
−
{{#set: common name=tributyrin}}
+
−
{{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=302.367    }}
+
−
{{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}}
+
−
{{#set: consumed by=RXN-12086}}
+

Latest revision as of 20:23, 21 March 2018

Metabolite R-3-hydroxymyristoyl-ACPs

  • common name:
    • a (3R)-3-hydroxymyristoyl-[acp]
  • Synonym(s):
    • a β-hydroxymyristoyl-[acp]
    • a (3R)-3-hydroxymyristoyl-[acyl-carrier protein]
    • an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxymyristoyl-[acp" cannot be used as a page name in this wiki.
  • "a β-hydroxymyristoyl-[acp" cannot be used as a page name in this wiki.
  • "a (3R)-3-hydroxymyristoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R-3-hydroxymyristoyl-ACPs&oldid=48362"