Difference between revisions of "CPD-458"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribulose-phosphates Ribulose-phosphates] == * common name: ** L(or D)-ribulose 5-phosphate * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * common name:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == |
+ | * smiles: | ||
+ | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O | ||
* common name: | * common name: | ||
− | ** | + | ** galactinol |
+ | * inchi key: | ||
+ | ** InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N | ||
+ | * molecular weight: | ||
+ | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-O-α-D-galactosyl-D-myo-inositol | ||
+ | ** 1-α-D-galactosyl-myo-inositol | ||
+ | ** α-D-galactosyl-(1->3)-1D-myo-inositol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.4.1.123-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[2.4.1.67-RXN]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: reversible reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202439 25202439] |
+ | * KEGG-GLYCAN : G10488 | ||
+ | * HMDB : HMDB05826 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01235 C01235] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17505 17505] | ||
+ | * METABOLIGHTS : MTBLC17505 | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O}} | ||
+ | {{#set: common name=galactinol}} | ||
+ | {{#set: inchi key=InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N}} | ||
+ | {{#set: molecular weight=342.299 }} | ||
+ | {{#set: common name=1-O-α-D-galactosyl-D-myo-inositol|1-α-D-galactosyl-myo-inositol|α-D-galactosyl-(1->3)-1D-myo-inositol}} | ||
+ | {{#set: consumed by=RXN-8281}} | ||
+ | {{#set: produced by=2.4.1.123-RXN}} | ||
+ | {{#set: reversible reaction associated=2.4.1.67-RXN}} |
Latest revision as of 21:23, 21 March 2018
Contents
Metabolite CPD-458
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O
- common name:
- galactinol
- inchi key:
- InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N
- molecular weight:
- 342.299
- Synonym(s):
- 1-O-α-D-galactosyl-D-myo-inositol
- 1-α-D-galactosyl-myo-inositol
- α-D-galactosyl-(1->3)-1D-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KEGG-GLYCAN : G10488
- HMDB : HMDB05826
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC17505
"α-D-galactosyl-(1->3)-1D-myo-inositol" cannot be used as a page name in this wiki.