Difference between revisions of "Tiso gene 5839"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * common name: ** L-histidine * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_5839 == * right end position: ** 4137 * transcription direction: ** POSITIVE * left end position: ** 3965 * centisome position: ** 30.79851...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5839 == |
− | * | + | * right end position: |
− | ** | + | ** 4137 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3965 |
− | * | + | * centisome position: |
− | ** | + | ** 30.79851 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADENYL-KIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | * [[ | + | * Reaction: [[ATAM]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | == | + | * Reaction: [[ATAMm]] |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[ATDAM]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[DEOXYADENYLATE-KINASE-RXN]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
+ | * [[PWY-7224]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4137}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3965}} | |
− | + | {{#set: centisome position=30.79851 }} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN|ATAM|ATAMm|ATDAM|DEOXYADENYLATE-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219|PWY-7224}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:24, 21 March 2018
Gene Tiso_gene_5839
- right end position:
- 4137
- transcription direction:
- POSITIVE
- left end position:
- 3965
- centisome position:
- 30.79851
- Synonym(s):
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: ATAM
- Source: orthology-creinhardtii
- Reaction: ATAMm
- Source: orthology-creinhardtii
- Reaction: ATDAM
- Source: orthology-creinhardtii
- Reaction: DEOXYADENYLATE-KINASE-RXN
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii