Difference between revisions of "CPD-13793"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1695 == * Synonym(s): == Reactions associated == * Reaction: GLYCINE-AMINOTRANSFERASE-RXN ** Source: orthology-creinhardtii == Pat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == |
+ | * smiles: | ||
+ | ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
+ | * common name: | ||
+ | ** 3-oxo-24-ethyl-cholest-5-ene | ||
+ | * inchi key: | ||
+ | ** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N | ||
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-12789]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811] |
+ | {{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=3-oxo-24-ethyl-cholest-5-ene}} | ||
+ | {{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}} | ||
+ | {{#set: molecular weight=412.698 }} | ||
+ | {{#set: produced by=RXN-12789}} |
Latest revision as of 21:24, 21 March 2018
Contents
Metabolite CPD-13793
- smiles:
- CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 3-oxo-24-ethyl-cholest-5-ene
- inchi key:
- InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.