Difference between revisions of "Tiso gene 3315"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * common name: ** tran...") |
(Created page with "Category:Gene == Gene Tiso_gene_3315 == * right end position: ** 16519 * transcription direction: ** POSITIVE * left end position: ** 14801 * centisome position: ** 86.911...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3315 == |
| − | * | + | * right end position: |
| − | ** | + | ** 16519 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 14801 |
| − | * | + | * centisome position: |
| − | ** | + | ** 86.91133 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[3.5.1.98-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: right end position=16519}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=14801}} | |
| − | + | {{#set: centisome position=86.91133 }} | |
| − | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:24, 21 March 2018
Gene Tiso_gene_3315
- right end position:
- 16519
- transcription direction:
- POSITIVE
- left end position:
- 14801
- centisome position:
- 86.91133
- Synonym(s):
Reactions associated
- Reaction: 3.5.1.98-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
