Difference between revisions of "DTDPDEHYRHAMREDUCT-RXN"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7801 PWY-7801] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) |
| + | * inchi key: | ||
| + | ** InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-dehydroshikimate |
| + | * molecular weight: | ||
| + | ** 171.129 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-dehydroshikimic acid | ||
| + | ** 5-dehydroshikimic acid | ||
| + | ** 5-dehydroshikimate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7968]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | * | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460360 5460360] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.4573915.html 4573915] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16630 16630] |
| + | * BIGG : 3dhsk | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02637 C02637] | ||
| + | {{#set: smiles=C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)}} | ||
| + | {{#set: inchi key=InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M}} | ||
| + | {{#set: common name=3-dehydroshikimate}} | ||
| + | {{#set: molecular weight=171.129 }} | ||
| + | {{#set: common name=3-dehydroshikimic acid|5-dehydroshikimic acid|5-dehydroshikimate}} | ||
| + | {{#set: consumed by=SHIKIMATE-5-DEHYDROGENASE-RXN}} | ||
| + | {{#set: produced by=RXN-7968}} | ||
| + | {{#set: consumed or produced by=3-DEHYDROQUINATE-DEHYDRATASE-RXN}} | ||
Revision as of 16:31, 10 January 2018
Contents
Metabolite 3-DEHYDRO-SHIKIMATE
- smiles:
- C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)
- inchi key:
- InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M
- common name:
- 3-dehydroshikimate
- molecular weight:
- 171.129
- Synonym(s):
- 3-dehydroshikimic acid
- 5-dehydroshikimic acid
- 5-dehydroshikimate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)" cannot be used as a page name in this wiki.
